CAS 27574-24-9 appears in our catalog under these names: Tropatepine, Tropatepine, 99.63%, Tropatepine-13C-d3. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 500mg, 50 mg, 100 mg, 10 mg, 25 mg, 5 mg.
(1R,5S)-3-(6H-benzo[c][1]benzothiepin-11-ylidene)-8-methyl-8-azabicyclo[3.2.1]octane (CAS 27574-24-9) is a chemical compound with the molecular formula C22H23NS and a molecular weight of 333.5 g/mol. IUPAC name: (1R,5S)-3-(6H-benzo[c][1]benzothiepin-11-ylidene)-8-methyl-8-azabicyclo[3.2.1]octane. InChIKey: JOQKFRLFXDPXHX-HDICACEKSA-N.
| Molecular formula | C22H23NS |
|---|---|
| Molecular weight | 333.5 g/mol |
| IUPAC name | (1R,5S)-3-(6H-benzo[c][1]benzothiepin-11-ylidene)-8-methyl-8-azabicyclo[3.2.1]octane |
| InChIKey | JOQKFRLFXDPXHX-HDICACEKSA-N |
| SMILES | CN1[C@@H]2CC[C@H]1CC(=C3C4=CC=CC=C4CSC5=CC=CC=C53)C2 |
Computed by PubChem (NCBI)