CAS 2757424-54-5 is the registry number for AR antagonist 14. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-4-iodobenzamide (CAS 2757424-54-5) is a chemical compound with the molecular formula C22H22ClIN2O2 and a molecular weight of 508.8 g/mol. IUPAC name: N-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-4-iodobenzamide. InChIKey: LJATYFYKWXQNLZ-UHFFFAOYSA-N.
| Molecular formula | C22H22ClIN2O2 |
|---|---|
| Molecular weight | 508.8 g/mol |
| IUPAC name | N-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-4-iodobenzamide |
| InChIKey | LJATYFYKWXQNLZ-UHFFFAOYSA-N |
| SMILES | CC1(C(C(C1OC2=CC(=C(C=C2)C#N)Cl)(C)C)NC(=O)C3=CC=C(C=C3)I)C |
Computed by PubChem (NCBI)