CAS 2757656-11-2 is the registry number for Cabotegravir Impurity 10. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,6S)-10-hydroxy-6-methyl-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxylic acid (CAS 2757656-11-2) is a chemical compound with the molecular formula C12H12N2O6 and a molecular weight of 280.23 g/mol. IUPAC name: (3R,6S)-10-hydroxy-6-methyl-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxylic acid. InChIKey: UTWWWJIQJNMMNH-CAHLUQPWSA-N.
| Molecular formula | C12H12N2O6 |
|---|---|
| Molecular weight | 280.23 g/mol |
| IUPAC name | (3R,6S)-10-hydroxy-6-methyl-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxylic acid |
| InChIKey | UTWWWJIQJNMMNH-CAHLUQPWSA-N |
| SMILES | C[C@H]1CO[C@H]2N1C(=O)C3=C(C(=O)C(=CN3C2)C(=O)O)O |
Computed by PubChem (NCBI)