CAS 189013-00-1 is the registry number for 1,1'-(2,3-Dihydroxybutane-1,4-diyl)bis(1H-pyrrole-2,5-dione), 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[4-(2,5-dioxopyrrol-1-yl)-2,3-dihydroxybutyl]pyrrole-2,5-dione (CAS 189013-00-1) is a chemical compound with the molecular formula C12H12N2O6 and a molecular weight of 280.23 g/mol. IUPAC name: 1-[4-(2,5-dioxopyrrol-1-yl)-2,3-dihydroxybutyl]pyrrole-2,5-dione. InChIKey: VNJBTKQBKFMEHH-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O6 |
|---|---|
| Molecular weight | 280.23 g/mol |
| IUPAC name | 1-[4-(2,5-dioxopyrrol-1-yl)-2,3-dihydroxybutyl]pyrrole-2,5-dione |
| InChIKey | VNJBTKQBKFMEHH-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CC(C(CN2C(=O)C=CC2=O)O)O |
Computed by PubChem (NCBI)