CAS 2757692-02-5 is the registry number for (S)-5-N-Fmoc-6,7-dihydro-5H-cyclopenta[b]pyridine-5-carboxylic acid, 95%. Offered by: Ambeed. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g.
(5S)-5-(9H-fluoren-9-ylmethoxycarbonylamino)-6,7-dihydrocyclopenta[b]pyridine-5-carboxylic acid (CAS 2757692-02-5) is a chemical compound with the molecular formula C24H20N2O4 and a molecular weight of 400.4 g/mol. IUPAC name: (5S)-5-(9H-fluoren-9-ylmethoxycarbonylamino)-6,7-dihydrocyclopenta[b]pyridine-5-carboxylic acid. InChIKey: VMSBPWCMIOOBAG-DEOSSOPVSA-N.
| Molecular formula | C24H20N2O4 |
|---|---|
| Molecular weight | 400.4 g/mol |
| IUPAC name | (5S)-5-(9H-fluoren-9-ylmethoxycarbonylamino)-6,7-dihydrocyclopenta[b]pyridine-5-carboxylic acid |
| InChIKey | VMSBPWCMIOOBAG-DEOSSOPVSA-N |
| SMILES | C1C[C@](C2=C1N=CC=C2)(C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)