Products 2241643-23-0
CAS 2241643-23-0 is the registry number for MPT0G413. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-hydroxy-4-[[5-(4-methoxybenzoyl)indol-1-yl]methyl]benzamide (CAS 2241643-23-0) is a chemical compound with the molecular formula C24H20N2O4 and a molecular weight of 400.4 g/mol. IUPAC name: N-hydroxy-4-[[5-(4-methoxybenzoyl)indol-1-yl]methyl]benzamide. InChIKey: JTINFDLICSLUSD-UHFFFAOYSA-N.
| Molecular formula | C24H20N2O4 |
|---|---|
| Molecular weight | 400.4 g/mol |
| IUPAC name | N-hydroxy-4-[[5-(4-methoxybenzoyl)indol-1-yl]methyl]benzamide |
| InChIKey | JTINFDLICSLUSD-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)C2=CC3=C(C=C2)N(C=C3)CC4=CC=C(C=C4)C(=O)NO |
Computed by PubChem (NCBI)