CAS 2757730-29-1 is the registry number for Methyl 1-(fluorosulfonyl)azetidine-3-carboxylate 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Methyl 1-fluorosulfonylazetidine-3-carboxylate (CAS 2757730-29-1) is a chemical compound with the molecular formula C5H8FNO4S and a molecular weight of 197.19 g/mol. IUPAC name: methyl 1-fluorosulfonylazetidine-3-carboxylate. InChIKey: FIWBGBCYONPYQJ-UHFFFAOYSA-N.
| Molecular formula | C5H8FNO4S |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | methyl 1-fluorosulfonylazetidine-3-carboxylate |
| InChIKey | FIWBGBCYONPYQJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CN(C1)S(=O)(=O)F |
Computed by PubChem (NCBI)