Products 2757731-62-5
CAS 2757731-62-5 is the registry number for 2-(2-(Benzyloxy)-5-bromo-3-fluorophenyl)-1,3-dioxolane, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2-(5-bromo-3-fluoro-2-phenylmethoxyphenyl)-1,3-dioxolane (CAS 2757731-62-5) is a chemical compound with the molecular formula C16H14BrFO3 and a molecular weight of 353.18 g/mol. IUPAC name: 2-(5-bromo-3-fluoro-2-phenylmethoxyphenyl)-1,3-dioxolane. InChIKey: WHZQSUKDZPHPMM-UHFFFAOYSA-N.
| Molecular formula | C16H14BrFO3 |
|---|---|
| Molecular weight | 353.18 g/mol |
| IUPAC name | 2-(5-bromo-3-fluoro-2-phenylmethoxyphenyl)-1,3-dioxolane |
| InChIKey | WHZQSUKDZPHPMM-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=C(C(=CC(=C2)Br)F)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)