CAS 2758146-05-1 is the registry number for 2-Aminobenzamide-13C6. Offered by: TRC. Available pack sizes: 25mg.
6-amino(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxamide (CAS 2758146-05-1) is a chemical compound with the molecular formula C7H8N2O and a molecular weight of 142.11 g/mol. IUPAC name: 6-amino(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxamide. InChIKey: PXBFMLJZNCDSMP-IDEBNGHGSA-N.
| Molecular formula | C7H8N2O |
|---|---|
| Molecular weight | 142.11 g/mol |
| IUPAC name | 6-amino(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxamide |
| InChIKey | PXBFMLJZNCDSMP-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13CH][13CH]=[13C]([13C](=[13CH]1)C(=O)N)N |
Computed by PubChem (NCBI)