Products 2758149-25-4
CAS 2758149-25-4 is the registry number for 6-Aminooctahydropyrido[1,2-b][1,2,6]thiadiazine 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,1-dioxo-2,3,4,4a,5,6,7,8-octahydropyrido[1,2-b][1,2,6]thiadiazin-6-amine (CAS 2758149-25-4) is a chemical compound with the molecular formula C7H15N3O2S and a molecular weight of 205.28 g/mol. IUPAC name: 1,1-dioxo-2,3,4,4a,5,6,7,8-octahydropyrido[1,2-b][1,2,6]thiadiazin-6-amine. InChIKey: DGZHUQXNSGQKHG-UHFFFAOYSA-N.
| Molecular formula | C7H15N3O2S |
|---|---|
| Molecular weight | 205.28 g/mol |
| IUPAC name | 1,1-dioxo-2,3,4,4a,5,6,7,8-octahydropyrido[1,2-b][1,2,6]thiadiazin-6-amine |
| InChIKey | DGZHUQXNSGQKHG-UHFFFAOYSA-N |
| SMILES | C1CNS(=O)(=O)N2C1CC(CC2)N |
Computed by PubChem (NCBI)