CAS 2758181-30-3 is the registry number for 4,4'-(Benzo[c][1,2,5]selenadiazole-4,7-diyl)bis(3-methoxybenzoic acid), 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[4-(4-carboxy-2-methoxyphenyl)-2,1,3-benzoselenadiazol-7-yl]-3-methoxybenzoic acid (CAS 2758181-30-3) is a chemical compound with the molecular formula C22H16N2O6Se and a molecular weight of 483.3 g/mol. IUPAC name: 4-[4-(4-carboxy-2-methoxyphenyl)-2,1,3-benzoselenadiazol-7-yl]-3-methoxybenzoic acid. InChIKey: ZCZJYNXVNWZVQH-UHFFFAOYSA-N.
| Molecular formula | C22H16N2O6Se |
|---|---|
| Molecular weight | 483.3 g/mol |
| IUPAC name | 4-[4-(4-carboxy-2-methoxyphenyl)-2,1,3-benzoselenadiazol-7-yl]-3-methoxybenzoic acid |
| InChIKey | ZCZJYNXVNWZVQH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(=O)O)C2=CC=C(C3=N[Se]N=C23)C4=C(C=C(C=C4)C(=O)O)OC |
Computed by PubChem (NCBI)