Products 2758256-71-0
CAS 2758256-71-0 is the registry number for NMDA receptor modulator 4. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[(3R)-7-(trifluoromethyl)-2,3-dihydro-1,4-benzoxathiin-3-yl]-1,4-dihydropyrazine-2,3-dione (CAS 2758256-71-0) is a chemical compound with the molecular formula C13H9F3N2O3S and a molecular weight of 330.28 g/mol. IUPAC name: 5-[(3R)-7-(trifluoromethyl)-2,3-dihydro-1,4-benzoxathiin-3-yl]-1,4-dihydropyrazine-2,3-dione. InChIKey: IYPSHXAEEWBZGE-JTQLQIEISA-N.
| Molecular formula | C13H9F3N2O3S |
|---|---|
| Molecular weight | 330.28 g/mol |
| IUPAC name | 5-[(3R)-7-(trifluoromethyl)-2,3-dihydro-1,4-benzoxathiin-3-yl]-1,4-dihydropyrazine-2,3-dione |
| InChIKey | IYPSHXAEEWBZGE-JTQLQIEISA-N |
| SMILES | C1[C@H](SC2=C(O1)C=C(C=C2)C(F)(F)F)C3=CNC(=O)C(=O)N3 |
Computed by PubChem (NCBI)
Synonyms:
NMDA receptor modulator 4, orb1689075