Products 2758256-97-0
CAS 2758256-97-0 is the registry number for NMDA receptor modulator 5. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[(3R)-3-methyl-7-(trifluoromethyl)-2H-1,4-benzoxathiin-3-yl]-1,4-dihydropyrazine-2,3-dione (CAS 2758256-97-0) is a chemical compound with the molecular formula C14H11F3N2O3S and a molecular weight of 344.31 g/mol. IUPAC name: 5-[(3R)-3-methyl-7-(trifluoromethyl)-2H-1,4-benzoxathiin-3-yl]-1,4-dihydropyrazine-2,3-dione. InChIKey: OQPPGZPVQXBCFK-ZDUSSCGKSA-N.
| Molecular formula | C14H11F3N2O3S |
|---|---|
| Molecular weight | 344.31 g/mol |
| IUPAC name | 5-[(3R)-3-methyl-7-(trifluoromethyl)-2H-1,4-benzoxathiin-3-yl]-1,4-dihydropyrazine-2,3-dione |
| InChIKey | OQPPGZPVQXBCFK-ZDUSSCGKSA-N |
| SMILES | C[C@]1(COC2=C(S1)C=CC(=C2)C(F)(F)F)C3=CNC(=O)C(=O)N3 |
Computed by PubChem (NCBI)
Synonyms:
NMDA receptor modulator 5, orb1688920