Products 2758411-39-9

CAS 2758411-39-9 is the registry number for 6-(((tert-Butyldiphenylsilyl)oxy)methyl)tetrahydro-2H-pyran-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxane-3-carboxylic acid (CAS 2758411-39-9) is a chemical compound with the molecular formula C23H30O4Si and a molecular weight of 398.6 g/mol. IUPAC name: 6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxane-3-carboxylic acid. InChIKey: WNOKHYKCOQNHJM-UHFFFAOYSA-N.

Identity
Molecular formulaC23H30O4Si
Molecular weight398.6 g/mol
IUPAC name6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxane-3-carboxylic acid
InChIKeyWNOKHYKCOQNHJM-UHFFFAOYSA-N
SMILESCC(C)(C)[Si](C1=CC=CC=C1)(C2=CC=CC=C2)OCC3CCC(CO3)C(=O)O

Computed by PubChem (NCBI)