Products 2758533-77-4
CAS 2758533-77-4 appears in our catalog under these names: CRBN ligand-109, 99.11%, CRBN ligand-109, 95%, CRBN ligand-109, 98%. Offered by: MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 100 mg, 1 g, 5 g, 25 mg, 250 mg, 500 mg, 50 mg, 100mg.
3-(4-bromo-2,6-difluorophenyl)piperidine-2,6-dione (CAS 2758533-77-4) is a chemical compound with the molecular formula C11H8BrF2NO2 and a molecular weight of 304.09 g/mol. IUPAC name: 3-(4-bromo-2,6-difluorophenyl)piperidine-2,6-dione. InChIKey: MBARMNDQAOCATN-UHFFFAOYSA-N.
| Molecular formula | C11H8BrF2NO2 |
|---|---|
| Molecular weight | 304.09 g/mol |
| IUPAC name | 3-(4-bromo-2,6-difluorophenyl)piperidine-2,6-dione |
| InChIKey | MBARMNDQAOCATN-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=C(C=C(C=C2F)Br)F |
Computed by PubChem (NCBI)