CAS 2758535-06-5 is the registry number for (6-Amino-2-ethyl-3-fluoroquinolin-5-yl)dimethylphosphine oxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-dimethylphosphoryl-2-ethyl-3-fluoroquinolin-6-amine (CAS 2758535-06-5) is a chemical compound with the molecular formula C13H16FN2OP and a molecular weight of 266.25 g/mol. IUPAC name: 5-dimethylphosphoryl-2-ethyl-3-fluoroquinolin-6-amine. InChIKey: ANIUUKZZVOHCJD-UHFFFAOYSA-N.
| Molecular formula | C13H16FN2OP |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | 5-dimethylphosphoryl-2-ethyl-3-fluoroquinolin-6-amine |
| InChIKey | ANIUUKZZVOHCJD-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=C2C(=N1)C=CC(=C2P(=O)(C)C)N)F |
Computed by PubChem (NCBI)