CAS 2758676-09-2 is the registry number for 7-Chloro-2-(difluoromethyl)-8,9-dimethyl-4H-pyrimido[1,2-b]pyridazin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-chloro-2-(difluoromethyl)-8,9-dimethylpyrimido[1,2-b]pyridazin-4-one (CAS 2758676-09-2) is a chemical compound with the molecular formula C10H8ClF2N3O and a molecular weight of 259.64 g/mol. IUPAC name: 7-chloro-2-(difluoromethyl)-8,9-dimethylpyrimido[1,2-b]pyridazin-4-one. InChIKey: DORFMJIYGGAKCJ-UHFFFAOYSA-N.
| Molecular formula | C10H8ClF2N3O |
|---|---|
| Molecular weight | 259.64 g/mol |
| IUPAC name | 7-chloro-2-(difluoromethyl)-8,9-dimethylpyrimido[1,2-b]pyridazin-4-one |
| InChIKey | DORFMJIYGGAKCJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN2C1=NC(=CC2=O)C(F)F)Cl)C |
Computed by PubChem (NCBI)