Products 2758756-38-4
CAS 2758756-38-4 is the registry number for Rel-(2R,7aS)-2-fluoro-7a-methylhexahydro-1H-pyrrolizine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,8S)-2-fluoro-8-methyl-1,2,3,5,6,7-hexahydropyrrolizine (CAS 2758756-38-4) is a chemical compound with the molecular formula C8H14FN and a molecular weight of 143.20 g/mol. IUPAC name: (2R,8S)-2-fluoro-8-methyl-1,2,3,5,6,7-hexahydropyrrolizine. InChIKey: GHCMVWSBCOAZSE-SFYZADRCSA-N.
| Molecular formula | C8H14FN |
|---|---|
| Molecular weight | 143.20 g/mol |
| IUPAC name | (2R,8S)-2-fluoro-8-methyl-1,2,3,5,6,7-hexahydropyrrolizine |
| InChIKey | GHCMVWSBCOAZSE-SFYZADRCSA-N |
| SMILES | C[C@@]12CCCN1C[C@@H](C2)F |
Computed by PubChem (NCBI)