CAS 2758763-14-1 is the registry number for N,N-Diisopropyl-3-(1,10-phenanthrolin-2-yl)benzamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(1,10-phenanthrolin-2-yl)-N,N-di(propan-2-yl)benzamide (CAS 2758763-14-1) is a chemical compound with the molecular formula C25H25N3O and a molecular weight of 383.5 g/mol. IUPAC name: 3-(1,10-phenanthrolin-2-yl)-N,N-di(propan-2-yl)benzamide. InChIKey: SXJJDVHBLJKQLQ-UHFFFAOYSA-N.
| Molecular formula | C25H25N3O |
|---|---|
| Molecular weight | 383.5 g/mol |
| IUPAC name | 3-(1,10-phenanthrolin-2-yl)-N,N-di(propan-2-yl)benzamide |
| InChIKey | SXJJDVHBLJKQLQ-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(C)C)C(=O)C1=CC=CC(=C1)C2=NC3=C(C=CC4=C3N=CC=C4)C=C2 |
Computed by PubChem (NCBI)