CAS 2758802-03-6 is the registry number for HSD17B13-IN-11. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[(3-chloro-4-hydroxybenzoyl)amino]-N-(2-methylpropyl)thiophene-2-carboxamide (CAS 2758802-03-6) is a chemical compound with the molecular formula C16H17ClN2O3S and a molecular weight of 352.8 g/mol. IUPAC name: 3-[(3-chloro-4-hydroxybenzoyl)amino]-N-(2-methylpropyl)thiophene-2-carboxamide. InChIKey: VTKPWAXAHWOLLD-UHFFFAOYSA-N.
| Molecular formula | C16H17ClN2O3S |
|---|---|
| Molecular weight | 352.8 g/mol |
| IUPAC name | 3-[(3-chloro-4-hydroxybenzoyl)amino]-N-(2-methylpropyl)thiophene-2-carboxamide |
| InChIKey | VTKPWAXAHWOLLD-UHFFFAOYSA-N |
| SMILES | CC(C)CNC(=O)C1=C(C=CS1)NC(=O)C2=CC(=C(C=C2)O)Cl |
Computed by PubChem (NCBI)