CAS 2758802-05-8 is the registry number for HSD17B13-IN-14. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[(3-chloro-4-hydroxybenzoyl)amino]-N-(1H-indol-3-ylmethyl)thiophene-2-carboxamide (CAS 2758802-05-8) is a chemical compound with the molecular formula C21H16ClN3O3S and a molecular weight of 425.9 g/mol. IUPAC name: 3-[(3-chloro-4-hydroxybenzoyl)amino]-N-(1H-indol-3-ylmethyl)thiophene-2-carboxamide. InChIKey: YGJDFURVOBVBAJ-UHFFFAOYSA-N.
| Molecular formula | C21H16ClN3O3S |
|---|---|
| Molecular weight | 425.9 g/mol |
| IUPAC name | 3-[(3-chloro-4-hydroxybenzoyl)amino]-N-(1H-indol-3-ylmethyl)thiophene-2-carboxamide |
| InChIKey | YGJDFURVOBVBAJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CNC(=O)C3=C(C=CS3)NC(=O)C4=CC(=C(C=C4)O)Cl |
Computed by PubChem (NCBI)