CAS 2758802-09-2 is the registry number for HSD17B13-IN-16. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[(3-chloro-4-hydroxybenzoyl)amino]-N-[(2-methoxyphenyl)methyl]thiophene-2-carboxamide (CAS 2758802-09-2) is a chemical compound with the molecular formula C20H17ClN2O4S and a molecular weight of 416.9 g/mol. IUPAC name: 3-[(3-chloro-4-hydroxybenzoyl)amino]-N-[(2-methoxyphenyl)methyl]thiophene-2-carboxamide. InChIKey: AUWHJPLXZCPIPY-UHFFFAOYSA-N.
| Molecular formula | C20H17ClN2O4S |
|---|---|
| Molecular weight | 416.9 g/mol |
| IUPAC name | 3-[(3-chloro-4-hydroxybenzoyl)amino]-N-[(2-methoxyphenyl)methyl]thiophene-2-carboxamide |
| InChIKey | AUWHJPLXZCPIPY-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1CNC(=O)C2=C(C=CS2)NC(=O)C3=CC(=C(C=C3)O)Cl |
Computed by PubChem (NCBI)