Products 2759037-58-4
CAS 2759037-58-4 is the registry number for BI-10. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[bis(1H-indol-3-yl)methyl]-6-bromophenol (CAS 2759037-58-4) is a chemical compound with the molecular formula C23H17BrN2O and a molecular weight of 417.3 g/mol. IUPAC name: 2-[bis(1H-indol-3-yl)methyl]-6-bromophenol. InChIKey: WCNNKLPTJGOEQP-UHFFFAOYSA-N.
| Molecular formula | C23H17BrN2O |
|---|---|
| Molecular weight | 417.3 g/mol |
| IUPAC name | 2-[bis(1H-indol-3-yl)methyl]-6-bromophenol |
| InChIKey | WCNNKLPTJGOEQP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C(C3=C(C(=CC=C3)Br)O)C4=CNC5=CC=CC=C54 |
Computed by PubChem (NCBI)