CAS 2759727-47-2 is the registry number for β2AR agonist 5. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-3-(3-fluorophenyl)azetidin-3-ol (CAS 2759727-47-2) is a chemical compound with the molecular formula C19H17F2N3O and a molecular weight of 341.4 g/mol. IUPAC name: 1-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-3-(3-fluorophenyl)azetidin-3-ol. InChIKey: IBVYIHZZZPFCCT-UHFFFAOYSA-N.
| Molecular formula | C19H17F2N3O |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | 1-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-3-(3-fluorophenyl)azetidin-3-ol |
| InChIKey | IBVYIHZZZPFCCT-UHFFFAOYSA-N |
| SMILES | C1C(CN1CC2=CC(=C(C=C2)N3C=CN=C3)F)(C4=CC(=CC=C4)F)O |
Computed by PubChem (NCBI)