Products 2759919-13-4
CAS 2759919-13-4 is the registry number for 5-HT7R antagonist 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[5-(3-chlorophenyl)-1H-pyrazol-4-yl]-1,4-diazepane;hydrochloride (CAS 2759919-13-4) is a chemical compound with the molecular formula C14H18Cl2N4 and a molecular weight of 313.2 g/mol. IUPAC name: 1-[5-(3-chlorophenyl)-1H-pyrazol-4-yl]-1,4-diazepane;hydrochloride. InChIKey: ZLHJRJOVJMYMKL-UHFFFAOYSA-N.
| Molecular formula | C14H18Cl2N4 |
|---|---|
| Molecular weight | 313.2 g/mol |
| IUPAC name | 1-[5-(3-chlorophenyl)-1H-pyrazol-4-yl]-1,4-diazepane;hydrochloride |
| InChIKey | ZLHJRJOVJMYMKL-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)C2=C(NN=C2)C3=CC(=CC=C3)Cl.Cl |
Computed by PubChem (NCBI)
Synonyms:
5-HT7R antagonist 1