Products 2760128-88-7
CAS 2760128-88-7 is the registry number for Ethyl 2-(4-(2-bromoacetyl)-2,6-dimethylphenoxy)-2-methylpropanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-[4-(2-bromoacetyl)-2,6-dimethylphenoxy]-2-methylpropanoate (CAS 2760128-88-7) is a chemical compound with the molecular formula C16H21BrO4 and a molecular weight of 357.24 g/mol. IUPAC name: ethyl 2-[4-(2-bromoacetyl)-2,6-dimethylphenoxy]-2-methylpropanoate. InChIKey: IFMBWBRUVUKBGD-UHFFFAOYSA-N.
| Molecular formula | C16H21BrO4 |
|---|---|
| Molecular weight | 357.24 g/mol |
| IUPAC name | ethyl 2-[4-(2-bromoacetyl)-2,6-dimethylphenoxy]-2-methylpropanoate |
| InChIKey | IFMBWBRUVUKBGD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(C)OC1=C(C=C(C=C1C)C(=O)CBr)C |
Computed by PubChem (NCBI)