CAS 2760265-70-9 is the registry number for rel-(2R,5S)-2-(2,3-Dihydro-1H-inden-5-yl)-5-methylpiperidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,5S)-2-(2,3-dihydro-1H-inden-5-yl)-5-methylpiperidine (CAS 2760265-70-9) is a chemical compound with the molecular formula C15H21N and a molecular weight of 215.33 g/mol. IUPAC name: (2R,5S)-2-(2,3-dihydro-1H-inden-5-yl)-5-methylpiperidine. InChIKey: HHJCJBYHGPWMPN-XHDPSFHLSA-N.
| Molecular formula | C15H21N |
|---|---|
| Molecular weight | 215.33 g/mol |
| IUPAC name | (2R,5S)-2-(2,3-dihydro-1H-inden-5-yl)-5-methylpiperidine |
| InChIKey | HHJCJBYHGPWMPN-XHDPSFHLSA-N |
| SMILES | C[C@H]1CC[C@@H](NC1)C2=CC3=C(CCC3)C=C2 |
Computed by PubChem (NCBI)