Products 2760266-09-7
CAS 2760266-09-7 is the registry number for rel-(2R,5S)-2-(4-Chloro-3-methylphenyl)-5-methylpiperidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,5S)-2-(4-chloro-3-methylphenyl)-5-methylpiperidine (CAS 2760266-09-7) is a chemical compound with the molecular formula C13H18ClN and a molecular weight of 223.74 g/mol. IUPAC name: (2R,5S)-2-(4-chloro-3-methylphenyl)-5-methylpiperidine. InChIKey: QQVQVYDJAYTHOU-TVQRCGJNSA-N.
| Molecular formula | C13H18ClN |
|---|---|
| Molecular weight | 223.74 g/mol |
| IUPAC name | (2R,5S)-2-(4-chloro-3-methylphenyl)-5-methylpiperidine |
| InChIKey | QQVQVYDJAYTHOU-TVQRCGJNSA-N |
| SMILES | C[C@H]1CC[C@@H](NC1)C2=CC(=C(C=C2)Cl)C |
Computed by PubChem (NCBI)