CAS 2760267-04-5 is the registry number for rel-(2R,5S)-5-Methyl-2-(3,4,5-trifluorophenyl)piperidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,5S)-5-methyl-2-(3,4,5-trifluorophenyl)piperidine (CAS 2760267-04-5) is a chemical compound with the molecular formula C12H14F3N and a molecular weight of 229.24 g/mol. IUPAC name: (2R,5S)-5-methyl-2-(3,4,5-trifluorophenyl)piperidine. InChIKey: YCUTYMPRPAZTAV-WRWORJQWSA-N.
| Molecular formula | C12H14F3N |
|---|---|
| Molecular weight | 229.24 g/mol |
| IUPAC name | (2R,5S)-5-methyl-2-(3,4,5-trifluorophenyl)piperidine |
| InChIKey | YCUTYMPRPAZTAV-WRWORJQWSA-N |
| SMILES | C[C@H]1CC[C@@H](NC1)C2=CC(=C(C(=C2)F)F)F |
Computed by PubChem (NCBI)