Products 2760268-03-7
CAS 2760268-03-7 is the registry number for tert-butyl (2R,5S)-2-(1,3-benzothiazol-5-yl)-5-methyl-piperidine-1-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2R,5S)-2-(1,3-benzothiazol-5-yl)-5-methylpiperidine-1-carboxylate (CAS 2760268-03-7) is a chemical compound with the molecular formula C18H24N2O2S and a molecular weight of 332.5 g/mol. IUPAC name: tert-butyl (2R,5S)-2-(1,3-benzothiazol-5-yl)-5-methylpiperidine-1-carboxylate. InChIKey: SWCQHUFSTAGNIW-SWLSCSKDSA-N.
| Molecular formula | C18H24N2O2S |
|---|---|
| Molecular weight | 332.5 g/mol |
| IUPAC name | tert-butyl (2R,5S)-2-(1,3-benzothiazol-5-yl)-5-methylpiperidine-1-carboxylate |
| InChIKey | SWCQHUFSTAGNIW-SWLSCSKDSA-N |
| SMILES | C[C@H]1CC[C@@H](N(C1)C(=O)OC(C)(C)C)C2=CC3=C(C=C2)SC=N3 |
Computed by PubChem (NCBI)