CAS 2760268-68-4 is the registry number for 5-Chloro-2-(2,2-dimethylpiperidin-4-yl)benzo[d]thiazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-2-(2,2-dimethylpiperidin-4-yl)-1,3-benzothiazole (CAS 2760268-68-4) is a chemical compound with the molecular formula C14H17ClN2S and a molecular weight of 280.8 g/mol. IUPAC name: 5-chloro-2-(2,2-dimethylpiperidin-4-yl)-1,3-benzothiazole. InChIKey: BORYWGZQSAIULG-UHFFFAOYSA-N.
| Molecular formula | C14H17ClN2S |
|---|---|
| Molecular weight | 280.8 g/mol |
| IUPAC name | 5-chloro-2-(2,2-dimethylpiperidin-4-yl)-1,3-benzothiazole |
| InChIKey | BORYWGZQSAIULG-UHFFFAOYSA-N |
| SMILES | CC1(CC(CCN1)C2=NC3=C(S2)C=CC(=C3)Cl)C |
Computed by PubChem (NCBI)