CAS 2760271-39-2 is the registry number for rel-2-(2-Chloro-4-((2R,5S)-5-methylpiperidin-2-yl)phenyl)-N,N-dimethylethan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[2-chloro-4-[(2R,5S)-5-methylpiperidin-2-yl]phenyl]-N,N-dimethylethanamine (CAS 2760271-39-2) is a chemical compound with the molecular formula C16H25ClN2 and a molecular weight of 280.83 g/mol. IUPAC name: 2-[2-chloro-4-[(2R,5S)-5-methylpiperidin-2-yl]phenyl]-N,N-dimethylethanamine. InChIKey: CZRHDIRPWNOVRW-BLLLJJGKSA-N.
| Molecular formula | C16H25ClN2 |
|---|---|
| Molecular weight | 280.83 g/mol |
| IUPAC name | 2-[2-chloro-4-[(2R,5S)-5-methylpiperidin-2-yl]phenyl]-N,N-dimethylethanamine |
| InChIKey | CZRHDIRPWNOVRW-BLLLJJGKSA-N |
| SMILES | C[C@H]1CC[C@@H](NC1)C2=CC(=C(C=C2)CCN(C)C)Cl |
Computed by PubChem (NCBI)