CAS 1218-35-5 appears in our catalog under these names: Refer to O-029003, Xylometazoline HCl (Oxymetazoline EP Impurity B HCl), Oxymetazoline EP Impurity B HCl (Xylometazoline HCl), Xylometazoline Hydrochloride, >95% (HPLC), Xylometazoline Hydrochloride, Xylometazoline hydrochloride/ 99.83% (existing batch purity). Offered by: Chemat Brand, TRC, Mikromol, LoGiCal, TargetMol. Available pack sizes: on request, 1g, 50mg, 5g, 250mg, 10mg, 10mM (in 1ml dmso), 25g.
2-[(4-tert-butyl-2,6-dimethylphenyl)methyl]-4,5-dihydro-1H-imidazole;hydrochloride (CAS 1218-35-5) is a chemical compound with the molecular formula C16H25ClN2 and a molecular weight of 280.83 g/mol. IUPAC name: 2-[(4-tert-butyl-2,6-dimethylphenyl)methyl]-4,5-dihydro-1H-imidazole;hydrochloride. InChIKey: YGWFCQYETHJKNX-UHFFFAOYSA-N.
| Molecular formula | C16H25ClN2 |
|---|---|
| Molecular weight | 280.83 g/mol |
| IUPAC name | 2-[(4-tert-butyl-2,6-dimethylphenyl)methyl]-4,5-dihydro-1H-imidazole;hydrochloride |
| InChIKey | YGWFCQYETHJKNX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1CC2=NCCN2)C)C(C)(C)C.Cl |
Computed by PubChem (NCBI)