Products 2760271-40-5
CAS 2760271-40-5 is the registry number for N,N-Dimethyl-2-(3-((2R,5S)-5-methylpiperidin-2-yl)phenoxy)ethan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N,N-dimethyl-2-[3-[(2R,5S)-5-methylpiperidin-2-yl]phenoxy]ethanamine (CAS 2760271-40-5) is a chemical compound with the molecular formula C16H26N2O and a molecular weight of 262.39 g/mol. IUPAC name: N,N-dimethyl-2-[3-[(2R,5S)-5-methylpiperidin-2-yl]phenoxy]ethanamine. InChIKey: VOCJJIZLNZJMPV-XJKSGUPXSA-N.
| Molecular formula | C16H26N2O |
|---|---|
| Molecular weight | 262.39 g/mol |
| IUPAC name | N,N-dimethyl-2-[3-[(2R,5S)-5-methylpiperidin-2-yl]phenoxy]ethanamine |
| InChIKey | VOCJJIZLNZJMPV-XJKSGUPXSA-N |
| SMILES | C[C@H]1CC[C@@H](NC1)C2=CC(=CC=C2)OCCN(C)C |
Computed by PubChem (NCBI)