Products 2760368-99-6
CAS 2760368-99-6 is the registry number for N,N-Dimethyl-2-(4-((2R,5S)-5-methylpiperidin-2-yl)phenyl)ethan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N,N-dimethyl-2-[4-[(2R,5S)-5-methylpiperidin-2-yl]phenyl]ethanamine (CAS 2760368-99-6) is a chemical compound with the molecular formula C16H26N2 and a molecular weight of 246.39 g/mol. IUPAC name: N,N-dimethyl-2-[4-[(2R,5S)-5-methylpiperidin-2-yl]phenyl]ethanamine. InChIKey: LAIUWCKXPSJESB-XJKSGUPXSA-N.
| Molecular formula | C16H26N2 |
|---|---|
| Molecular weight | 246.39 g/mol |
| IUPAC name | N,N-dimethyl-2-[4-[(2R,5S)-5-methylpiperidin-2-yl]phenyl]ethanamine |
| InChIKey | LAIUWCKXPSJESB-XJKSGUPXSA-N |
| SMILES | C[C@H]1CC[C@@H](NC1)C2=CC=C(C=C2)CCN(C)C |
Computed by PubChem (NCBI)