CAS 2760370-36-1 is the registry number for (S)-6-(Benzo[b]thiophen-5-yl)-3-methyl-2,3,4,5-tetrahydropyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S)-6-(1-benzothiophen-5-yl)-3-methyl-2,3,4,5-tetrahydropyridine (CAS 2760370-36-1) is a chemical compound with the molecular formula C14H15NS and a molecular weight of 229.34 g/mol. IUPAC name: (3S)-6-(1-benzothiophen-5-yl)-3-methyl-2,3,4,5-tetrahydropyridine. InChIKey: RPESCDWQRBYXSI-JTQLQIEISA-N.
| Molecular formula | C14H15NS |
|---|---|
| Molecular weight | 229.34 g/mol |
| IUPAC name | (3S)-6-(1-benzothiophen-5-yl)-3-methyl-2,3,4,5-tetrahydropyridine |
| InChIKey | RPESCDWQRBYXSI-JTQLQIEISA-N |
| SMILES | C[C@H]1CCC(=NC1)C2=CC3=C(C=C2)SC=C3 |
Computed by PubChem (NCBI)