CAS 2760486-69-7 is the registry number for rel-2-Methyl-5-((2S,5R)-5-methylpiperidin-2-yl)benzo[d]thiazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-5-[(2S,5R)-5-methylpiperidin-2-yl]-1,3-benzothiazole (CAS 2760486-69-7) is a chemical compound with the molecular formula C14H18N2S and a molecular weight of 246.37 g/mol. IUPAC name: 2-methyl-5-[(2S,5R)-5-methylpiperidin-2-yl]-1,3-benzothiazole. InChIKey: WFUONPLWLOEQHZ-SKDRFNHKSA-N.
| Molecular formula | C14H18N2S |
|---|---|
| Molecular weight | 246.37 g/mol |
| IUPAC name | 2-methyl-5-[(2S,5R)-5-methylpiperidin-2-yl]-1,3-benzothiazole |
| InChIKey | WFUONPLWLOEQHZ-SKDRFNHKSA-N |
| SMILES | C[C@@H]1CC[C@H](NC1)C2=CC3=C(C=C2)SC(=N3)C |
Computed by PubChem (NCBI)