CAS 2760487-01-0 is the registry number for rel-(2S,5R)-5-Methyl-2-(1H-pyrazol-4-yl)piperidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,5R)-5-methyl-2-(1H-pyrazol-4-yl)piperidine (CAS 2760487-01-0) is a chemical compound with the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. IUPAC name: (2S,5R)-5-methyl-2-(1H-pyrazol-4-yl)piperidine. InChIKey: MLEOLYZTPUPLCH-APPZFPTMSA-N.
| Molecular formula | C9H15N3 |
|---|---|
| Molecular weight | 165.24 g/mol |
| IUPAC name | (2S,5R)-5-methyl-2-(1H-pyrazol-4-yl)piperidine |
| InChIKey | MLEOLYZTPUPLCH-APPZFPTMSA-N |
| SMILES | C[C@@H]1CC[C@H](NC1)C2=CNN=C2 |
Computed by PubChem (NCBI)