CAS 2760487-08-7 is the registry number for rel-(2R,5S)-N,5-Dimethyl-[2,3'-bipiperidine]-1'-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-methyl-3-[(2R,5S)-5-methylpiperidin-2-yl]piperidine-1-carboxamide (CAS 2760487-08-7) is a chemical compound with the molecular formula C13H25N3O and a molecular weight of 239.36 g/mol. IUPAC name: N-methyl-3-[(2R,5S)-5-methylpiperidin-2-yl]piperidine-1-carboxamide. InChIKey: GHGRGKXIRVVRNE-ASKATJPDSA-N.
| Molecular formula | C13H25N3O |
|---|---|
| Molecular weight | 239.36 g/mol |
| IUPAC name | N-methyl-3-[(2R,5S)-5-methylpiperidin-2-yl]piperidine-1-carboxamide |
| InChIKey | GHGRGKXIRVVRNE-ASKATJPDSA-N |
| SMILES | C[C@H]1CC[C@@H](NC1)C2CCCN(C2)C(=O)NC |
Computed by PubChem (NCBI)