CAS 2760487-09-8 is the registry number for rel-1-((2R,5S)-5-Methyl-[2,3'-bipiperidin]-1'-yl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[3-[(2R,5S)-5-methylpiperidin-2-yl]piperidin-1-yl]ethanone (CAS 2760487-09-8) is a chemical compound with the molecular formula C13H24N2O and a molecular weight of 224.34 g/mol. IUPAC name: 1-[3-[(2R,5S)-5-methylpiperidin-2-yl]piperidin-1-yl]ethanone. InChIKey: CUQOEDFFLHFXJZ-RDWQBYKPSA-N.
| Molecular formula | C13H24N2O |
|---|---|
| Molecular weight | 224.34 g/mol |
| IUPAC name | 1-[3-[(2R,5S)-5-methylpiperidin-2-yl]piperidin-1-yl]ethanone |
| InChIKey | CUQOEDFFLHFXJZ-RDWQBYKPSA-N |
| SMILES | C[C@H]1CC[C@@H](NC1)C2CCCN(C2)C(=O)C |
Computed by PubChem (NCBI)