CAS 2760487-21-4 is the registry number for rel-6-((2S,5R)-5-Methylpiperidin-2-yl)isoquinolin-1(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-[(2S,5R)-5-methylpiperidin-2-yl]-2H-isoquinolin-1-one (CAS 2760487-21-4) is a chemical compound with the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. IUPAC name: 6-[(2S,5R)-5-methylpiperidin-2-yl]-2H-isoquinolin-1-one. InChIKey: YQSUCJSNFILJLC-YGRLFVJLSA-N.
| Molecular formula | C15H18N2O |
|---|---|
| Molecular weight | 242.32 g/mol |
| IUPAC name | 6-[(2S,5R)-5-methylpiperidin-2-yl]-2H-isoquinolin-1-one |
| InChIKey | YQSUCJSNFILJLC-YGRLFVJLSA-N |
| SMILES | C[C@@H]1CC[C@H](NC1)C2=CC3=C(C=C2)C(=O)NC=C3 |
Computed by PubChem (NCBI)