Products 2760487-62-3
CAS 2760487-62-3 is the registry number for tert-Butyl (5-nitro-3-vinylpyridin-2-yl)carbamate, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl N-(3-ethenyl-5-nitro-2-pyridinyl)carbamate (CAS 2760487-62-3) is a chemical compound with the molecular formula C12H15N3O4 and a molecular weight of 265.26 g/mol. IUPAC name: tert-butyl N-(3-ethenyl-5-nitro-2-pyridinyl)carbamate. InChIKey: LNCOZRNBMXJFFT-UHFFFAOYSA-N.
| Molecular formula | C12H15N3O4 |
|---|---|
| Molecular weight | 265.26 g/mol |
| IUPAC name | tert-butyl N-(3-ethenyl-5-nitro-2-pyridinyl)carbamate |
| InChIKey | LNCOZRNBMXJFFT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=C(C=N1)[N+](=O)[O-])C=C |
Computed by PubChem (NCBI)