Products 2760488-03-5
CAS 2760488-03-5 is the registry number for rel-(2R,5R)-1-Benzyl-5-methyl-2-phenylpiperidin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,5R)-1-benzyl-5-methyl-2-phenylpiperidin-4-one (CAS 2760488-03-5) is a chemical compound with the molecular formula C19H21NO and a molecular weight of 279.4 g/mol. IUPAC name: (2R,5R)-1-benzyl-5-methyl-2-phenylpiperidin-4-one. InChIKey: PHWWOQCIKLQCID-CRAIPNDOSA-N.
| Molecular formula | C19H21NO |
|---|---|
| Molecular weight | 279.4 g/mol |
| IUPAC name | (2R,5R)-1-benzyl-5-methyl-2-phenylpiperidin-4-one |
| InChIKey | PHWWOQCIKLQCID-CRAIPNDOSA-N |
| SMILES | C[C@@H]1CN([C@H](CC1=O)C2=CC=CC=C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)