CAS 2760488-93-3 is the registry number for rel-1-((2R,5S)-5-Methyl-[2,3'-bipiperidin]-1'-yl)ethan-1-one hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[3-[(2R,5S)-5-methylpiperidin-2-yl]piperidin-1-yl]ethanone;hydrochloride (CAS 2760488-93-3) is a chemical compound with the molecular formula C13H25ClN2O and a molecular weight of 260.80 g/mol. IUPAC name: 1-[3-[(2R,5S)-5-methylpiperidin-2-yl]piperidin-1-yl]ethanone;hydrochloride. InChIKey: IWQGUSYYEBFZEO-QEEMAICNSA-N.
| Molecular formula | C13H25ClN2O |
|---|---|
| Molecular weight | 260.80 g/mol |
| IUPAC name | 1-[3-[(2R,5S)-5-methylpiperidin-2-yl]piperidin-1-yl]ethanone;hydrochloride |
| InChIKey | IWQGUSYYEBFZEO-QEEMAICNSA-N |
| SMILES | C[C@H]1CC[C@@H](NC1)C2CCCN(C2)C(=O)C.Cl |
Computed by PubChem (NCBI)