CAS 2760488-94-4 is the registry number for rel-tert-Butyl (2R,5S)-1',5-dimethyl-[2,3'-bipiperidine]-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2R,5S)-5-methyl-2-(1-methylpiperidin-3-yl)piperidine-1-carboxylate (CAS 2760488-94-4) is a chemical compound with the molecular formula C17H32N2O2 and a molecular weight of 296.4 g/mol. IUPAC name: tert-butyl (2R,5S)-5-methyl-2-(1-methylpiperidin-3-yl)piperidine-1-carboxylate. InChIKey: IQNIMCDFPPAGBR-ZHDDOTHNSA-N.
| Molecular formula | C17H32N2O2 |
|---|---|
| Molecular weight | 296.4 g/mol |
| IUPAC name | tert-butyl (2R,5S)-5-methyl-2-(1-methylpiperidin-3-yl)piperidine-1-carboxylate |
| InChIKey | IQNIMCDFPPAGBR-ZHDDOTHNSA-N |
| SMILES | C[C@H]1CC[C@@H](N(C1)C(=O)OC(C)(C)C)C2CCCN(C2)C |
Computed by PubChem (NCBI)