Products 2760515-88-4
CAS 2760515-88-4 is the registry number for mG2N001. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-(2-fluoro-4-methoxyphenyl)-2,2-dimethyl-3,4-dihydropyrano[2,3-b]pyridine-7-carboxamide (CAS 2760515-88-4) is a chemical compound with the molecular formula C18H19FN2O3 and a molecular weight of 330.4 g/mol. IUPAC name: 5-(2-fluoro-4-methoxyphenyl)-2,2-dimethyl-3,4-dihydropyrano[2,3-b]pyridine-7-carboxamide. InChIKey: BGZMSLRKXOWQCL-UHFFFAOYSA-N.
| Molecular formula | C18H19FN2O3 |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | 5-(2-fluoro-4-methoxyphenyl)-2,2-dimethyl-3,4-dihydropyrano[2,3-b]pyridine-7-carboxamide |
| InChIKey | BGZMSLRKXOWQCL-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C(O1)N=C(C=C2C3=C(C=C(C=C3)OC)F)C(=O)N)C |
Computed by PubChem (NCBI)