CAS 2760566-74-1 is the registry number for 2-((2R,5S)-2-(4-Fluorophenyl)-5-methylpiperidin-1-yl)-2-oxoacetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(2R,5S)-2-(4-fluorophenyl)-5-methylpiperidin-1-yl]-2-oxoacetamide (CAS 2760566-74-1) is a chemical compound with the molecular formula C14H17FN2O2 and a molecular weight of 264.29 g/mol. IUPAC name: 2-[(2R,5S)-2-(4-fluorophenyl)-5-methylpiperidin-1-yl]-2-oxoacetamide. InChIKey: KXUCKRMVDSVHCY-JOYOIKCWSA-N.
| Molecular formula | C14H17FN2O2 |
|---|---|
| Molecular weight | 264.29 g/mol |
| IUPAC name | 2-[(2R,5S)-2-(4-fluorophenyl)-5-methylpiperidin-1-yl]-2-oxoacetamide |
| InChIKey | KXUCKRMVDSVHCY-JOYOIKCWSA-N |
| SMILES | C[C@H]1CC[C@@H](N(C1)C(=O)C(=O)N)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)