CAS 2760568-40-7 is the registry number for rel-2-(tert-Butyl)-4-((2R,5S)-5-methylpiperidin-2-yl)phenol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-tert-butyl-4-[(2R,5S)-5-methylpiperidin-2-yl]phenol (CAS 2760568-40-7) is a chemical compound with the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. IUPAC name: 2-tert-butyl-4-[(2R,5S)-5-methylpiperidin-2-yl]phenol. InChIKey: BWXMDMFNJJOIJY-SMDDNHRTSA-N.
| Molecular formula | C16H25NO |
|---|---|
| Molecular weight | 247.38 g/mol |
| IUPAC name | 2-tert-butyl-4-[(2R,5S)-5-methylpiperidin-2-yl]phenol |
| InChIKey | BWXMDMFNJJOIJY-SMDDNHRTSA-N |
| SMILES | C[C@H]1CC[C@@H](NC1)C2=CC(=C(C=C2)O)C(C)(C)C |
Computed by PubChem (NCBI)