CAS 27607-33-6 appears in our catalog under these names: Cis-1,2-cyclooctanediol, 95%, cis–1,2–Cyclooctanediol, cis-Cyclooctane-1,2-diol, >95.0%(GC), Cis-cyclooctane-1,2-diol 97%, Cis-cyclooctane-1,2-diol, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Fluorochem. Available pack sizes: 5g, 25g, 1g, 200mg, 100g.
Cis-(1S,2R)-cyclooctane-1,2-diol (CAS 27607-33-6) is a chemical compound with the molecular formula C8H16O2 and a molecular weight of 144.21 g/mol. IUPAC name: cis-(1S,2R)-cyclooctane-1,2-diol. InChIKey: HUSOFJYAGDTKSK-OCAPTIKFSA-N.
| Molecular formula | C8H16O2 |
|---|---|
| Molecular weight | 144.21 g/mol |
| IUPAC name | cis-(1S,2R)-cyclooctane-1,2-diol |
| InChIKey | HUSOFJYAGDTKSK-OCAPTIKFSA-N |
| SMILES | C1CCC[C@@H]([C@@H](CC1)O)O |
Computed by PubChem (NCBI)