Products 2760972-52-7
CAS 2760972-52-7 is the registry number for Antiviral agent 35. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-benzyl-N-naphthalen-1-yl-4-nitrobenzenesulfonamide (CAS 2760972-52-7) is a chemical compound with the molecular formula C23H18N2O4S and a molecular weight of 418.5 g/mol. IUPAC name: N-benzyl-N-naphthalen-1-yl-4-nitrobenzenesulfonamide. InChIKey: GJZCHLIWCQDKMK-UHFFFAOYSA-N.
| Molecular formula | C23H18N2O4S |
|---|---|
| Molecular weight | 418.5 g/mol |
| IUPAC name | N-benzyl-N-naphthalen-1-yl-4-nitrobenzenesulfonamide |
| InChIKey | GJZCHLIWCQDKMK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN(C2=CC=CC3=CC=CC=C32)S(=O)(=O)C4=CC=C(C=C4)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
Antiviral agent 35, orb2277850